ChemNet > CAS > 23576-81-0 6-chloroimidazo[2,1-b][1,3]thiazole
23576-81-0 6-chloroimidazo[2,1-b][1,3]thiazole
| 상품명칭 |
6-chloroimidazo[2,1-b][1,3]thiazole |
| 영문 이름 |
6-chloroimidazo[2,1-b][1,3]thiazole; |
| 분자식 |
C5H3ClN2S |
| 분자량 |
158.6087 |
| InChI |
InChI=1/C5H3ClN2S/c6-4-3-8-1-2-9-5(8)7-4/h1-3H |
| cas번호 |
23576-81-0 |
| 분자 구조 |
![23576-81-0 6-chloroimidazo[2,1-b][1,3]thiazole](https://images-a.chemnet.com/suppliers/chembase/296/29635.gif)
|
| 밀도 |
1.66g/cm3 |
| 녹는 점 |
82℃ |
| 굴절 지수 |
1.78 |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
